C15H27N5OS — CID 111757959
N'-(2-methoxy-3,3-dimethylbutyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111757959) has the molecular formula C15H27N5OS and a molecular weight of 325.48 g/mol. Its IUPAC name is N'-(2-methoxy-3,3-dimethylbutyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-(2-methoxy-3,3-dimethylbutyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111757959 |
| Molecular Formula | C15H27N5OS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N'-(2-methoxy-3,3-dimethylbutyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | COC(C/N=C(\N)N1CCN(c2nccs2)CC1)C(C)(C)C |
| InChI | InChI=1S/C15H27N5OS/c1-15(2,3)12(21-4)11-18-13(16)19-6-8-20(9-7-19)14-17-5-10-22-14/h5,10,12H,6-9,11H2,1-4H3,(H2,16,18) |
| InChIKey | FLCGFFCPQHLYPZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|