C18H24F2N6S — CID 111814388
N'-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111814388) has the molecular formula C18H24F2N6S and a molecular weight of 394.50 g/mol. Its IUPAC name is N'-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111814388 |
| Molecular Formula | C18H24F2N6S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N'-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CN(C)C(C/N=C(\N)N1CCN(c2nccs2)CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C18H24F2N6S/c1-24(2)15(16-13(19)4-3-5-14(16)20)12-23-17(21)25-7-9-26(10-8-25)18-22-6-11-27-18/h3-6,11,15H,7-10,12H2,1-2H3,(H2,21,23) |
| InChIKey | FFTHOLABDBXPRM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|