C16H20FN5S — CID 111035438
N'-[2-(3-fluorophenyl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111035438) has the molecular formula C16H20FN5S and a molecular weight of 333.44 g/mol. Its IUPAC name is N'-[2-(3-fluorophenyl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(3-fluorophenyl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111035438 |
| Molecular Formula | C16H20FN5S |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N'-[2-(3-fluorophenyl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCc1cccc(F)c1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C16H20FN5S/c17-14-3-1-2-13(12-14)4-5-19-15(18)21-7-9-22(10-8-21)16-20-6-11-23-16/h1-3,6,11-12H,4-5,7-10H2,(H2,18,19) |
| InChIKey | SXDBWSZMQRBQIJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|