C16H20FN5OS — CID 111057966
N'-[2-(3-fluorophenoxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111057966) has the molecular formula C16H20FN5OS and a molecular weight of 349.44 g/mol. Its IUPAC name is N'-[2-(3-fluorophenoxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(3-fluorophenoxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111057966 |
| Molecular Formula | C16H20FN5OS |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N'-[2-(3-fluorophenoxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCOc1cccc(F)c1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C16H20FN5OS/c17-13-2-1-3-14(12-13)23-10-4-19-15(18)21-6-8-22(9-7-21)16-20-5-11-24-16/h1-3,5,11-12H,4,6-10H2,(H2,18,19) |
| InChIKey | FZFJNNOASYKEKU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|