C15H18F2IN5S — CID 75468898
N'-[(2,6-difluorophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 75468898) has the molecular formula C15H18F2IN5S and a molecular weight of 465.31 g/mol. Its IUPAC name is N'-[(2,6-difluorophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(2,6-difluorophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 75468898 |
| Molecular Formula | C15H18F2IN5S |
| Molecular Weight | 465.31 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | N'-[(2,6-difluorophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1c(F)cccc1F)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H17F2N5S.HI/c16-12-2-1-3-13(17)11(12)10-20-14(18)21-5-7-22(8-6-21)15-19-4-9-23-15;/h1-4,9H,5-8,10H2,(H2,18,20);1H |
| InChIKey | HQRLGSQLCYFYOK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|