C16H19IN6S — CID 111052269
N'-[(3-cyanophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111052269) has the molecular formula C16H19IN6S and a molecular weight of 454.34 g/mol. Its IUPAC name is N'-[(3-cyanophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(3-cyanophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111052269 |
| Molecular Formula | C16H19IN6S |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | N'-[(3-cyanophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N#Cc1cccc(C/N=C(\N)N2CCN(c3nccs3)CC2)c1 |
| InChI | InChI=1S/C16H18N6S.HI/c17-11-13-2-1-3-14(10-13)12-20-15(18)21-5-7-22(8-6-21)16-19-4-9-23-16;/h1-4,9-10H,5-8,12H2,(H2,18,20);1H |
| InChIKey | CLNOIPVDZIFTPF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|