C22H33IN6S — CID 111087198
N'-[[3-(azepan-1-ylmethyl)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111087198) has the molecular formula C22H33IN6S and a molecular weight of 540.52 g/mol. Its IUPAC name is N'-[[3-(azepan-1-ylmethyl)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[3-(azepan-1-ylmethyl)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111087198 |
| Molecular Formula | C22H33IN6S |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | N'-[[3-(azepan-1-ylmethyl)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(CN2CCCCCC2)c1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C22H32N6S.HI/c23-21(27-11-13-28(14-12-27)22-24-8-15-29-22)25-17-19-6-5-7-20(16-19)18-26-9-3-1-2-4-10-26;/h5-8,15-16H,1-4,9-14,17-18H2,(H2,23,25);1H |
| InChIKey | JRCOSXOZEXYDLM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|