C17H23IN6OS — CID 111058866
3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 111058866) has the molecular formula C17H23IN6OS and a molecular weight of 486.38 g/mol. Its IUPAC name is 3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111058866 |
| Molecular Formula | C17H23IN6OS |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | CNC(=O)c1cccc(C/N=C(\N)N2CCN(c3nccs3)CC2)c1.I |
| InChI | InChI=1S/C17H22N6OS.HI/c1-19-15(24)14-4-2-3-13(11-14)12-21-16(18)22-6-8-23(9-7-22)17-20-5-10-25-17;/h2-5,10-11H,6-9,12H2,1H3,(H2,18,21)(H,19,24);1H |
| InChIKey | MGEKBKUGEDHWMI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|