C14H18N6O2S — CID 111601304
5-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]furan-2-carboxamide (PubChem CID 111601304) has the molecular formula C14H18N6O2S and a molecular weight of 334.41 g/mol. Its IUPAC name is 5-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111601304 |
| Molecular Formula | C14H18N6O2S |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 5-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]furan-2-carboxamide |
| SMILES | NC(=O)c1ccc(C/N=C(\N)N2CCN(c3nccs3)CC2)o1 |
| InChI | InChI=1S/C14H18N6O2S/c15-12(21)11-2-1-10(22-11)9-18-13(16)19-4-6-20(7-5-19)14-17-3-8-23-14/h1-3,8H,4-7,9H2,(H2,15,21)(H2,16,18) |
| InChIKey | LJYUCVOQRAETCP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|