C15H18FN5OS — CID 111817122
N'-[(3-fluoro-4-hydroxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111817122) has the molecular formula C15H18FN5OS and a molecular weight of 335.41 g/mol. Its IUPAC name is N'-[(3-fluoro-4-hydroxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(3-fluoro-4-hydroxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111817122 |
| Molecular Formula | C15H18FN5OS |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N'-[(3-fluoro-4-hydroxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(O)c(F)c1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H18FN5OS/c16-12-9-11(1-2-13(12)22)10-19-14(17)20-4-6-21(7-5-20)15-18-3-8-23-15/h1-3,8-9,22H,4-7,10H2,(H2,17,19) |
| InChIKey | RFEXIAVAKDZXNI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|