C15H18FN5S — CID 111025747
N'-[(4-fluorophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111025747) has the molecular formula C15H18FN5S and a molecular weight of 319.41 g/mol. Its IUPAC name is N'-[(4-fluorophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(4-fluorophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111025747 |
| Molecular Formula | C15H18FN5S |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N'-[(4-fluorophenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(F)cc1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H18FN5S/c16-13-3-1-12(2-4-13)11-19-14(17)20-6-8-21(9-7-20)15-18-5-10-22-15/h1-5,10H,6-9,11H2,(H2,17,19) |
| InChIKey | HREUUHLXMHHLAN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|