C19H27N5S — CID 111045490
N'-[(4-tert-butylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111045490) has the molecular formula C19H27N5S and a molecular weight of 357.53 g/mol. Its IUPAC name is N'-[(4-tert-butylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(4-tert-butylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111045490 |
| Molecular Formula | C19H27N5S |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | N'-[(4-tert-butylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CC(C)(C)c1ccc(C/N=C(\N)N2CCN(c3nccs3)CC2)cc1 |
| InChI | InChI=1S/C19H27N5S/c1-19(2,3)16-6-4-15(5-7-16)14-22-17(20)23-9-11-24(12-10-23)18-21-8-13-25-18/h4-8,13H,9-12,14H2,1-3H3,(H2,20,22) |
| InChIKey | POVGNQJYVBFRLR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|