C16H22IN5S — CID 111026007
N'-[(4-methylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111026007) has the molecular formula C16H22IN5S and a molecular weight of 443.36 g/mol. Its IUPAC name is N'-[(4-methylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4-methylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111026007 |
| Molecular Formula | C16H22IN5S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N'-[(4-methylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | Cc1ccc(C/N=C(\N)N2CCN(c3nccs3)CC2)cc1.I |
| InChI | InChI=1S/C16H21N5S.HI/c1-13-2-4-14(5-3-13)12-19-15(17)20-7-9-21(10-8-20)16-18-6-11-22-16;/h2-6,11H,7-10,12H2,1H3,(H2,17,19);1H |
| InChIKey | CQLNMOOPIRZLFW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|