C17H24IN5OS — CID 111095769
N'-[(4-methoxy-3-methylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111095769) has the molecular formula C17H24IN5OS and a molecular weight of 473.38 g/mol. Its IUPAC name is N'-[(4-methoxy-3-methylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4-methoxy-3-methylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111095769 |
| Molecular Formula | C17H24IN5OS |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | N'-[(4-methoxy-3-methylphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)N2CCN(c3nccs3)CC2)cc1C.I |
| InChI | InChI=1S/C17H23N5OS.HI/c1-13-11-14(3-4-15(13)23-2)12-20-16(18)21-6-8-22(9-7-21)17-19-5-10-24-17;/h3-5,10-11H,6-9,12H2,1-2H3,(H2,18,20);1H |
| InChIKey | XPSQKXSKKHQPCO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|