C18H24ClN5O2S — CID 111068613
N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111068613) has the molecular formula C18H24ClN5O2S and a molecular weight of 409.94 g/mol. Its IUPAC name is N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111068613 |
| Molecular Formula | C18H24ClN5O2S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CCOc1c(Cl)cc(C/N=C(\N)N2CCN(c3nccs3)CC2)cc1OC |
| InChI | InChI=1S/C18H24ClN5O2S/c1-3-26-16-14(19)10-13(11-15(16)25-2)12-22-17(20)23-5-7-24(8-6-23)18-21-4-9-27-18/h4,9-11H,3,5-8,12H2,1-2H3,(H2,20,22) |
| InChIKey | MFOJLTKUHAZYNC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|