C22H27IN6O2S — CID 111051251
N'-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111051251) has the molecular formula C22H27IN6O2S and a molecular weight of 566.47 g/mol. Its IUPAC name is N'-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111051251 |
| Molecular Formula | C22H27IN6O2S |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | N'-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCOc1ccccc1Oc1ccc(C/N=C(\N)N2CCN(c3nccs3)CC2)cn1.I |
| InChI | InChI=1S/C22H26N6O2S.HI/c1-2-29-18-5-3-4-6-19(18)30-20-8-7-17(15-25-20)16-26-21(23)27-10-12-28(13-11-27)22-24-9-14-31-22;/h3-9,14-15H,2,10-13,16H2,1H3,(H2,23,26);1H |
| InChIKey | QYEMBBXTRJHJQL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|