C19H26N6OS — CID 111050076
N'-[(6-cyclopentyloxy-3-pyridinyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111050076) has the molecular formula C19H26N6OS and a molecular weight of 386.53 g/mol. Its IUPAC name is N'-[(6-cyclopentyloxy-3-pyridinyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(6-cyclopentyloxy-3-pyridinyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111050076 |
| Molecular Formula | C19H26N6OS |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N'-[(6-cyclopentyloxy-3-pyridinyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(OC2CCCC2)nc1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C19H26N6OS/c20-18(24-8-10-25(11-9-24)19-21-7-12-27-19)23-14-15-5-6-17(22-13-15)26-16-3-1-2-4-16/h5-7,12-13,16H,1-4,8-11,14H2,(H2,20,23) |
| InChIKey | IYUBQGMCHDOGOE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|