C19H28N6OS — CID 111084049
N'-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111084049) has the molecular formula C19H28N6OS and a molecular weight of 388.54 g/mol. Its IUPAC name is N'-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111084049 |
| Molecular Formula | C19H28N6OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N'-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CN(C)CCOc1ccccc1C/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C19H28N6OS/c1-23(2)12-13-26-17-6-4-3-5-16(17)15-22-18(20)24-8-10-25(11-9-24)19-21-7-14-27-19/h3-7,14H,8-13,15H2,1-2H3,(H2,20,22) |
| InChIKey | LXVKSUBACXJURN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|