C19H23N7S — CID 110027055
N'-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 110027055) has the molecular formula C19H23N7S and a molecular weight of 381.51 g/mol. Its IUPAC name is N'-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110027055 |
| Molecular Formula | C19H23N7S |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N'-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | Cc1nn(-c2ccccc2)cc1C/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C19H23N7S/c1-15-16(14-26(23-15)17-5-3-2-4-6-17)13-22-18(20)24-8-10-25(11-9-24)19-21-7-12-27-19/h2-7,12,14H,8-11,13H2,1H3,(H2,20,22) |
| InChIKey | HRJWIAQYTUIEKE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|