C20H25N7S — CID 111033835
N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111033835) has the molecular formula C20H25N7S and a molecular weight of 395.54 g/mol. Its IUPAC name is N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111033835 |
| Molecular Formula | C20H25N7S |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C20H25N7S/c1-15-18(16(2)27(24-15)17-6-4-3-5-7-17)14-23-19(21)25-9-11-26(12-10-25)20-22-8-13-28-20/h3-8,13H,9-12,14H2,1-2H3,(H2,21,23) |
| InChIKey | GSOLBSWBHJWHKX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|