C21H31N7S — CID 111059099
N'-[3-(4-phenylpiperazin-1-yl)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111059099) has the molecular formula C21H31N7S and a molecular weight of 413.60 g/mol. Its IUPAC name is N'-[3-(4-phenylpiperazin-1-yl)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[3-(4-phenylpiperazin-1-yl)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111059099 |
| Molecular Formula | C21H31N7S |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N'-[3-(4-phenylpiperazin-1-yl)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCCN1CCN(c2ccccc2)CC1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C21H31N7S/c22-20(27-14-16-28(17-15-27)21-24-8-18-29-21)23-7-4-9-25-10-12-26(13-11-25)19-5-2-1-3-6-19/h1-3,5-6,8,18H,4,7,9-17H2,(H2,22,23) |
| InChIKey | AKEDSOLBWSUPPW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|