C19H28IN5OS — CID 111035771
N'-[3-(1-phenylethoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111035771) has the molecular formula C19H28IN5OS and a molecular weight of 501.44 g/mol. Its IUPAC name is N'-[3-(1-phenylethoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(1-phenylethoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111035771 |
| Molecular Formula | C19H28IN5OS |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | N'-[3-(1-phenylethoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CC(OCCC/N=C(\N)N1CCN(c2nccs2)CC1)c1ccccc1.I |
| InChI | InChI=1S/C19H27N5OS.HI/c1-16(17-6-3-2-4-7-17)25-14-5-8-21-18(20)23-10-12-24(13-11-23)19-22-9-15-26-19;/h2-4,6-7,9,15-16H,5,8,10-14H2,1H3,(H2,20,21);1H |
| InChIKey | NRSSGSVMIFHDEQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|