C14H25N5OS — CID 111026160
N'-(3-propan-2-yloxypropyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111026160) has the molecular formula C14H25N5OS and a molecular weight of 311.45 g/mol. Its IUPAC name is N'-(3-propan-2-yloxypropyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-(3-propan-2-yloxypropyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111026160 |
| Molecular Formula | C14H25N5OS |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N'-(3-propan-2-yloxypropyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CC(C)OCCC/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C14H25N5OS/c1-12(2)20-10-3-4-16-13(15)18-6-8-19(9-7-18)14-17-5-11-21-14/h5,11-12H,3-4,6-10H2,1-2H3,(H2,15,16) |
| InChIKey | OXQZFKVAUAAYSD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|