C18H31N5OS — CID 111601046
N'-(3-cyclopentyl-3-ethoxypropyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111601046) has the molecular formula C18H31N5OS and a molecular weight of 365.55 g/mol. Its IUPAC name is N'-(3-cyclopentyl-3-ethoxypropyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-(3-cyclopentyl-3-ethoxypropyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111601046 |
| Molecular Formula | C18H31N5OS |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N'-(3-cyclopentyl-3-ethoxypropyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CCOC(CC/N=C(\N)N1CCN(c2nccs2)CC1)C1CCCC1 |
| InChI | InChI=1S/C18H31N5OS/c1-2-24-16(15-5-3-4-6-15)7-8-20-17(19)22-10-12-23(13-11-22)18-21-9-14-25-18/h9,14-16H,2-8,10-13H2,1H3,(H2,19,20) |
| InChIKey | LYSNFDNKCSCURQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|