C16H28N6S — CID 111803536
N'-[(1-ethylpiperidin-2-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111803536) has the molecular formula C16H28N6S and a molecular weight of 336.51 g/mol. Its IUPAC name is N'-[(1-ethylpiperidin-2-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(1-ethylpiperidin-2-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111803536 |
| Molecular Formula | C16H28N6S |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | N'-[(1-ethylpiperidin-2-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN1CCCCC1C/N=C(\N)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C16H28N6S/c1-2-20-7-4-3-5-14(20)13-19-15(17)21-8-10-22(11-9-21)16-18-6-12-23-16/h6,12,14H,2-5,7-11,13H2,1H3,(H2,17,19) |
| InChIKey | UZBHYEYFGPXATI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|