C14H26IN5OS — CID 111075048
N'-(2-butoxyethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111075048) has the molecular formula C14H26IN5OS and a molecular weight of 439.37 g/mol. Its IUPAC name is N'-(2-butoxyethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2-butoxyethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111075048 |
| Molecular Formula | C14H26IN5OS |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N'-(2-butoxyethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCCCOCC/N=C(\N)N1CCN(c2nccs2)CC1.I |
| InChI | InChI=1S/C14H25N5OS.HI/c1-2-3-10-20-11-4-16-13(15)18-6-8-19(9-7-18)14-17-5-12-21-14;/h5,12H,2-4,6-11H2,1H3,(H2,15,16);1H |
| InChIKey | CAJWOWAMGDHBBF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|