C20H30IN5O2S — CID 110018499
N'-[3-(2-phenylmethoxyethoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 110018499) has the molecular formula C20H30IN5O2S and a molecular weight of 531.46 g/mol. Its IUPAC name is N'-[3-(2-phenylmethoxyethoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(2-phenylmethoxyethoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110018499 |
| Molecular Formula | C20H30IN5O2S |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | N'-[3-(2-phenylmethoxyethoxy)propyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCCOCCOCc1ccccc1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C20H29N5O2S.HI/c21-19(24-9-11-25(12-10-24)20-23-8-16-28-20)22-7-4-13-26-14-15-27-17-18-5-2-1-3-6-18;/h1-3,5-6,8,16H,4,7,9-15,17H2,(H2,21,22);1H |
| InChIKey | OUTCTNQNOGGVJD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|