C18H26IN5OS — CID 111071317
N'-[2-(2,6-dimethylphenoxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111071317) has the molecular formula C18H26IN5OS and a molecular weight of 487.41 g/mol. Its IUPAC name is N'-[2-(2,6-dimethylphenoxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(2,6-dimethylphenoxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111071317 |
| Molecular Formula | C18H26IN5OS |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N'-[2-(2,6-dimethylphenoxy)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | Cc1cccc(C)c1OCC/N=C(\N)N1CCN(c2nccs2)CC1.I |
| InChI | InChI=1S/C18H25N5OS.HI/c1-14-4-3-5-15(2)16(14)24-12-6-20-17(19)22-8-10-23(11-9-22)18-21-7-13-25-18;/h3-5,7,13H,6,8-12H2,1-2H3,(H2,19,20);1H |
| InChIKey | RGQUWSAXIWDJRK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|