C13H23IN6OS — CID 111068258
3-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 111068258) has the molecular formula C13H23IN6OS and a molecular weight of 438.34 g/mol. Its IUPAC name is 3-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111068258 |
| Molecular Formula | C13H23IN6OS |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 3-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | CN(C)C(=O)CC/N=C(\N)N1CCN(c2nccs2)CC1.I |
| InChI | InChI=1S/C13H22N6OS.HI/c1-17(2)11(20)3-4-15-12(14)18-6-8-19(9-7-18)13-16-5-10-21-13;/h5,10H,3-4,6-9H2,1-2H3,(H2,14,15);1H |
| InChIKey | XGQYMBDTYYXGOU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|