C12H21IN6OS — CID 111032115
2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N-ethylacetamide;hydroiodide (PubChem CID 111032115) has the molecular formula C12H21IN6OS and a molecular weight of 424.31 g/mol. Its IUPAC name is 2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N-ethylacetamide;hydroiodide.
| Compound Name | 2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N-ethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111032115 |
| Molecular Formula | C12H21IN6OS |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N-ethylacetamide;hydroiodide |
| SMILES | CCNC(=O)C/N=C(\N)N1CCN(c2nccs2)CC1.I |
| InChI | InChI=1S/C12H20N6OS.HI/c1-2-14-10(19)9-16-11(13)17-4-6-18(7-5-17)12-15-3-8-20-12;/h3,8H,2,4-7,9H2,1H3,(H2,13,16)(H,14,19);1H |
| InChIKey | XVMVWHTVTMCVAU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|