C16H18F3IN6OS — CID 111028395
2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111028395) has the molecular formula C16H18F3IN6OS and a molecular weight of 526.33 g/mol. Its IUPAC name is 2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111028395 |
| Molecular Formula | C16H18F3IN6OS |
| Molecular Weight | 526.33 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | 2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | I.N/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C16H17F3N6OS.HI/c17-10-1-2-11(14(19)13(10)18)23-12(26)9-22-15(20)24-4-6-25(7-5-24)16-21-3-8-27-16;/h1-3,8H,4-7,9H2,(H2,20,22)(H,23,26);1H |
| InChIKey | KELYYABEVDTZSC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|