C18H25FIN5S — CID 111101386
N'-[2-(4-fluorophenyl)-2-methylpropyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111101386) has the molecular formula C18H25FIN5S and a molecular weight of 489.40 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)-2-methylpropyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(4-fluorophenyl)-2-methylpropyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111101386 |
| Molecular Formula | C18H25FIN5S |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | N'-[2-(4-fluorophenyl)-2-methylpropyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CC(C)(C/N=C(\N)N1CCN(c2nccs2)CC1)c1ccc(F)cc1.I |
| InChI | InChI=1S/C18H24FN5S.HI/c1-18(2,14-3-5-15(19)6-4-14)13-22-16(20)23-8-10-24(11-9-23)17-21-7-12-25-17;/h3-7,12H,8-11,13H2,1-2H3,(H2,20,22);1H |
| InChIKey | KJUXUVAPHRYHJI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|