C19H26N6OS — CID 111061557
N-[4-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]phenyl]butanamide (PubChem CID 111061557) has the molecular formula C19H26N6OS and a molecular weight of 386.53 g/mol. Its IUPAC name is N-[4-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]phenyl]butanamide.
| Compound Name | N-[4-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 111061557 |
| Molecular Formula | C19H26N6OS |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-[4-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(C/N=C(\N)N2CCN(c3nccs3)CC2)cc1 |
| InChI | InChI=1S/C19H26N6OS/c1-2-3-17(26)23-16-6-4-15(5-7-16)14-22-18(20)24-9-11-25(12-10-24)19-21-8-13-27-19/h4-8,13H,2-3,9-12,14H2,1H3,(H2,20,22)(H,23,26) |
| InChIKey | FBNJBWQSTGYDEE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|