C18H26IN5 — CID 110026747
4-methyl-N'-[(3-methyl-1-phenylpyrazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 110026747) has the molecular formula C18H26IN5 and a molecular weight of 439.35 g/mol. Its IUPAC name is 4-methyl-N'-[(3-methyl-1-phenylpyrazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-methyl-N'-[(3-methyl-1-phenylpyrazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110026747 |
| Molecular Formula | C18H26IN5 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 4-methyl-N'-[(3-methyl-1-phenylpyrazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | Cc1nn(-c2ccccc2)cc1C/N=C(\N)N1CCC(C)CC1.I |
| InChI | InChI=1S/C18H25N5.HI/c1-14-8-10-22(11-9-14)18(19)20-12-16-13-23(21-15(16)2)17-6-4-3-5-7-17;/h3-7,13-14H,8-12H2,1-2H3,(H2,19,20);1H |
| InChIKey | PKOKUXFYZUCAAJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|