C18H25N5O — CID 110920712
N'-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-4-methylpiperidine-1-carboximidamide (PubChem CID 110920712) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is N'-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110920712 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | N'-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-4-methylpiperidine-1-carboximidamide |
| SMILES | COc1ccc(-n2ccc(C/N=C(\N)N3CCC(C)CC3)n2)cc1 |
| InChI | InChI=1S/C18H25N5O/c1-14-7-10-22(11-8-14)18(19)20-13-15-9-12-23(21-15)16-3-5-17(24-2)6-4-16/h3-6,9,12,14H,7-8,10-11,13H2,1-2H3,(H2,19,20) |
| InChIKey | LGEKXYMRYYREAI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|