C11H18N4O — CID 111601356
4-methyl-N'-(1,2-oxazol-3-ylmethyl)piperidine-1-carboximidamide (PubChem CID 111601356) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-methyl-N'-(1,2-oxazol-3-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | 4-methyl-N'-(1,2-oxazol-3-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111601356 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 4-methyl-N'-(1,2-oxazol-3-ylmethyl)piperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(N)=N/Cc2ccon2)CC1 |
| InChI | InChI=1S/C11H18N4O/c1-9-2-5-15(6-3-9)11(12)13-8-10-4-7-16-14-10/h4,7,9H,2-3,5-6,8H2,1H3,(H2,12,13) |
| InChIKey | XODVFGBQROIHJZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|