C16H22N6 — CID 110920726
4-methyl-N'-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]piperidine-1-carboximidamide (PubChem CID 110920726) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-methyl-N'-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]piperidine-1-carboximidamide.
| Compound Name | 4-methyl-N'-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110920726 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 4-methyl-N'-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]piperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(N)=N/Cc2ccc(-n3cncn3)cc2)CC1 |
| InChI | InChI=1S/C16H22N6/c1-13-6-8-21(9-7-13)16(17)19-10-14-2-4-15(5-3-14)22-12-18-11-20-22/h2-5,11-13H,6-10H2,1H3,(H2,17,19) |
| InChIKey | MTVTWWKKOYRYLS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|