C14H20N6 — CID 111071801
1,1,3,3-tetramethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine (PubChem CID 111071801) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111071801 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
| SMILES | CN(C)C(=NCc1ccc(-n2cncn2)cc1)N(C)C |
| InChI | InChI=1S/C14H20N6/c1-18(2)14(19(3)4)16-9-12-5-7-13(8-6-12)20-11-15-10-17-20/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | ACNRYRUAUBPMOT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|