C20H33N7 — CID 111247965
1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine (PubChem CID 111247965) has the molecular formula C20H33N7 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111247965 |
| Molecular Formula | C20H33N7 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2cncn2)cc1)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C20H33N7/c1-6-22-20(23-11-12-26(16(2)3)17(4)5)24-13-18-7-9-19(10-8-18)27-15-21-14-25-27/h7-10,14-17H,6,11-13H2,1-5H3,(H2,22,23,24) |
| InChIKey | KPZVSIIQPMKAHB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|