C23H29N7O — CID 111670122
3-[2-[[N-ethyl-N'-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111670122) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-[2-[[N-ethyl-N'-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[N-ethyl-N'-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111670122 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 3-[2-[[N-ethyl-N'-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(-n2cncn2)cc1)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C23H29N7O/c1-4-25-23(26-13-12-18-6-5-7-20(14-18)22(31)29(2)3)27-15-19-8-10-21(11-9-19)30-17-24-16-28-30/h5-11,14,16-17H,4,12-13,15H2,1-3H3,(H2,25,26,27) |
| InChIKey | UMXMILDKKVCSDU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|