C19H31IN4S — CID 111047033
N'-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111047033) has the molecular formula C19H31IN4S and a molecular weight of 474.46 g/mol. Its IUPAC name is N'-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111047033 |
| Molecular Formula | C19H31IN4S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | N'-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1CCN(Cc2ccc(C/N=C(\N)N3CCSCC3)cc2)CC1.I |
| InChI | InChI=1S/C19H30N4S.HI/c1-16-6-8-22(9-7-16)15-18-4-2-17(3-5-18)14-21-19(20)23-10-12-24-13-11-23;/h2-5,16H,6-15H2,1H3,(H2,20,21);1H |
| InChIKey | OHZPRNHJPVCACH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|