C13H20N4O2S2 — CID 119118332
N'-[[4-(methanesulfonamido)phenyl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 119118332) has the molecular formula C13H20N4O2S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N'-[[4-(methanesulfonamido)phenyl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[[4-(methanesulfonamido)phenyl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 119118332 |
| Molecular Formula | C13H20N4O2S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N'-[[4-(methanesulfonamido)phenyl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | CS(=O)(=O)Nc1ccc(C/N=C(\N)N2CCSCC2)cc1 |
| InChI | InChI=1S/C13H20N4O2S2/c1-21(18,19)16-12-4-2-11(3-5-12)10-15-13(14)17-6-8-20-9-7-17/h2-5,16H,6-10H2,1H3,(H2,14,15) |
| InChIKey | UHHOZOLHFLBUPW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|