C17H26N4O2S2 — CID 111066755
N'-[(4-piperidin-1-ylsulfonylphenyl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 111066755) has the molecular formula C17H26N4O2S2 and a molecular weight of 382.56 g/mol. Its IUPAC name is N'-[(4-piperidin-1-ylsulfonylphenyl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(4-piperidin-1-ylsulfonylphenyl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111066755 |
| Molecular Formula | C17H26N4O2S2 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N'-[(4-piperidin-1-ylsulfonylphenyl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(S(=O)(=O)N2CCCCC2)cc1)N1CCSCC1 |
| InChI | InChI=1S/C17H26N4O2S2/c18-17(20-10-12-24-13-11-20)19-14-15-4-6-16(7-5-15)25(22,23)21-8-2-1-3-9-21/h4-7H,1-3,8-14H2,(H2,18,19) |
| InChIKey | NJSSUGCITSVCKR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|