C13H18N2O2S2 — CID 79186250
2-(4-piperidin-1-ylsulfonylphenyl)ethanethioamide (PubChem CID 79186250) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-(4-piperidin-1-ylsulfonylphenyl)ethanethioamide.
| Compound Name | 2-(4-piperidin-1-ylsulfonylphenyl)ethanethioamide |
|---|---|
| PubChem CID | 79186250 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-(4-piperidin-1-ylsulfonylphenyl)ethanethioamide |
| SMILES | NC(=S)Cc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C13H18N2O2S2/c14-13(18)10-11-4-6-12(7-5-11)19(16,17)15-8-2-1-3-9-15/h4-7H,1-3,8-10H2,(H2,14,18) |
| InChIKey | APSDVVPOGPCEHS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|