C12H19ClN2O2S — CID 53229799
2-(4-pyrrolidin-1-ylsulfonylphenyl)ethanamine;hydrochloride (PubChem CID 53229799) has the molecular formula C12H19ClN2O2S and a molecular weight of 290.82 g/mol. Its IUPAC name is 2-(4-pyrrolidin-1-ylsulfonylphenyl)ethanamine;hydrochloride.
| Compound Name | 2-(4-pyrrolidin-1-ylsulfonylphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 53229799 |
| Molecular Formula | C12H19ClN2O2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-(4-pyrrolidin-1-ylsulfonylphenyl)ethanamine;hydrochloride |
| SMILES | Cl.NCCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C12H18N2O2S.ClH/c13-8-7-11-3-5-12(6-4-11)17(15,16)14-9-1-2-10-14;/h3-6H,1-2,7-10,13H2;1H |
| InChIKey | JVVDJPBHXFTCSN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |