C14H18NNaO4S — CID 23692705
sodium 3-(4-piperidin-1-ylsulfonylphenyl)propanoate (PubChem CID 23692705) has the molecular formula C14H18NNaO4S and a molecular weight of 319.36 g/mol. Its IUPAC name is sodium 3-(4-piperidin-1-ylsulfonylphenyl)propanoate.
| Compound Name | sodium 3-(4-piperidin-1-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 23692705 |
| Molecular Formula | C14H18NNaO4S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | sodium 3-(4-piperidin-1-ylsulfonylphenyl)propanoate |
| SMILES | O=C([O-])CCc1ccc(S(=O)(=O)N2CCCCC2)cc1.[Na+] |
| InChI | InChI=1S/C14H19NO4S.Na/c16-14(17)9-6-12-4-7-13(8-5-12)20(18,19)15-10-2-1-3-11-15;/h4-5,7-8H,1-3,6,9-11H2,(H,16,17);/q;+1/p-1 |
| InChIKey | PFJGIKUVFVVPKD-UHFFFAOYSA-M |
| XLogP | -2.45 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |