C24H36N2O3S — CID 60535288
N-(cyclohexylmethyl)-N-cyclopropyl-3-(4-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 60535288) has the molecular formula C24H36N2O3S and a molecular weight of 432.63 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-cyclopropyl-3-(4-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-(cyclohexylmethyl)-N-cyclopropyl-3-(4-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 60535288 |
| Molecular Formula | C24H36N2O3S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | N-(cyclohexylmethyl)-N-cyclopropyl-3-(4-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCCC2)cc1)N(CC1CCCCC1)C1CC1 |
| InChI | InChI=1S/C24H36N2O3S/c27-24(26(22-12-13-22)19-21-7-3-1-4-8-21)16-11-20-9-14-23(15-10-20)30(28,29)25-17-5-2-6-18-25/h9-10,14-15,21-22H,1-8,11-13,16-19H2 |
| InChIKey | CCCFLBYRSRTHEZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |