C23H28N2O3S — CID 46420855
N-benzyl-N-cyclopropyl-2-(4-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 46420855) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is N-benzyl-N-cyclopropyl-2-(4-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | N-benzyl-N-cyclopropyl-2-(4-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 46420855 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-benzyl-N-cyclopropyl-2-(4-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)cc1)N(Cc1ccccc1)C1CC1 |
| InChI | InChI=1S/C23H28N2O3S/c26-23(25(21-11-12-21)18-20-7-3-1-4-8-20)17-19-9-13-22(14-10-19)29(27,28)24-15-5-2-6-16-24/h1,3-4,7-10,13-14,21H,2,5-6,11-12,15-18H2 |
| InChIKey | VZYAUBIEUXREMS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |