C22H26N2O3S — CID 46438624
1-(benzenesulfonyl)-N-benzyl-N-cyclopropylpiperidine-3-carboxamide (PubChem CID 46438624) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-benzyl-N-cyclopropylpiperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-benzyl-N-cyclopropylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46438624 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-(benzenesulfonyl)-N-benzyl-N-cyclopropylpiperidine-3-carboxamide |
| SMILES | O=C(C1CCCN(S(=O)(=O)c2ccccc2)C1)N(Cc1ccccc1)C1CC1 |
| InChI | InChI=1S/C22H26N2O3S/c25-22(24(20-13-14-20)16-18-8-3-1-4-9-18)19-10-7-15-23(17-19)28(26,27)21-11-5-2-6-12-21/h1-6,8-9,11-12,19-20H,7,10,13-17H2 |
| InChIKey | ZXDSALACXDSKLV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |