C24H31N3O5S2 — CID 28561875
1-(benzenesulfonyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 28561875) has the molecular formula C24H31N3O5S2 and a molecular weight of 505.66 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 28561875 |
| Molecular Formula | C24H31N3O5S2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCCCC2)cc1)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H31N3O5S2/c28-24(21-13-17-27(18-14-21)33(29,30)22-7-3-1-4-8-22)25-19-20-9-11-23(12-10-20)34(31,32)26-15-5-2-6-16-26/h1,3-4,7-12,21H,2,5-6,13-19H2,(H,25,28) |
| InChIKey | HAGWVHSZKHFADU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |